191-24-2 Benzo[ghi]perylene
| ürün Ad? |
Benzo[ghi]perylene |
| ingilizce ad? |
Benzo[ghi]perylene; 1,12-Benzoperylene; Benzo[ghi]perylene (purity); benzo(g h i)perylene |
| Moleküler Formülü |
C22H12 |
| Molekül A??rl??? |
276.3307 |
| InChI |
InChI=1/C22H12/c1-3-13-7-9-15-11-12-16-10-8-14-4-2-6-18-17(5-1)19(13)21(15)22(16)20(14)18/h1-12H |
| CAS kay?t numaras? |
191-24-2 |
| EINECS |
205-883-8 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.378g/cm3 |
| Ergime noktas? |
276-280℃ |
| Kaynama noktas? |
501°C at 760 mmHg |
| K?r?lma indisi |
2.009 |
| Alevlenme noktas? |
247.2°C |
| Buhar bas?nc? |
1.12E-09mmHg at 25°C |
| Tehlike Sembolleri |
Xn:Harmful;
|
| Risk Kodlar? |
R40:Possible risks of irreversible effects.;
|
| Güvenlik A??klamas? |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|